CAS 951888-27-0

(3,4-Dichlorophenyl)[2-(methylthio)phenyl]methanone

Description:

(3,4-Dichlorophenyl)[2-(methylthio)phenyl]methanone, with the CAS number 951888-27-0, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and a methylthio-substituted phenyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high stability under standard conditions and potential reactivity due to the presence of the carbonyl functional group. The dichlorophenyl substituent may impart increased lipophilicity and influence the compound's biological activity, while the methylthio group can affect its electronic properties and steric hindrance. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of chlorine atoms can enhance the compound's reactivity and may contribute to its environmental persistence. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₁₄H₁₀Cl₂OS

InChI: InChI=1S/C14H10Cl2OS/c1-18-13-5-3-2-4-10(13)14(17)9-6-7-11(15)12(16)8-9/h2-8H,1H3

InChI key: InChIKey=JBSRPNVURWAOES-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• (3,4-Dichlorophenyl)[2-(methylthio)phenyl]methanone
• Methanone, (3,4-dichlorophenyl)[2-(methylthio)phenyl]-

3,4-Dichloro-2′-(thiomethyl)benzophenone

CAS: 951888-27-0

Formula: C₁₄H₁₀Cl₂OS

Purity: 97.0%

Molecular weight: 297.19

Ref: 10-F202228