CAS 951888-30-5

Methanone, (3,5-dichlorophenyl)[2-(methylthio)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[2-(methylthio)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that chlorine atoms are substituted at the 3 and 5 positions of a phenyl ring, contributing to the compound's reactivity and potential biological activity. The second aromatic ring is substituted with a methylthio group, which can influence the compound's solubility and electronic properties. This compound may exhibit properties typical of both ketones and aromatic compounds, such as potential reactivity in electrophilic substitution reactions. Its unique structure suggests possible applications in pharmaceuticals or agrochemicals, where such substitutions can enhance biological activity or selectivity. As with many organic compounds, the specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.

Formula: C₁₄H₁₀Cl₂OS

InChI: InChI=1S/C14H10Cl2OS/c1-18-13-5-3-2-4-12(13)14(17)9-6-10(15)8-11(16)7-9/h2-8H,1H3

InChI key: InChIKey=TXYWZXASMHXKIF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• (3,5-Dichlorophenyl)-(2-methylsulfanylphenyl)methanone
• Methanone, (3,5-dichlorophenyl)[2-(methylthio)phenyl]-
• 3,5-Dichloro-2'-(thiomethyl)benzophenone

3,5-Dichloro-2′-(thiomethyl)benzophenone

CAS: 951888-30-5

Formula: C₁₄H₁₀Cl₂OS

Purity: 97.0%

Molecular weight: 297.19

Ref: 10-F202229