CymitQuimica logo

CAS 951888-33-8

:

Methanone, (2-bromophenyl)[4-(methylthio)phenyl]-

Description:
Methanone, (2-bromophenyl)[4-(methylthio)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a bromine atom at the 2-position of one phenyl ring contributes to its reactivity and potential applications in various chemical reactions. The methylthio group at the 4-position of the second phenyl ring enhances its properties, potentially influencing its solubility and electronic characteristics. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests that it could participate in electrophilic substitution reactions due to the electron-withdrawing effects of the bromine atom. Additionally, the methylthio group may provide sites for further functionalization. Overall, the compound's unique combination of functional groups and substituents makes it a valuable candidate for research in organic synthesis and pharmaceutical development.
Formula:C14H11BrOS
InChI:InChI=1S/C14H11BrOS/c1-17-11-8-6-10(7-9-11)14(16)12-4-2-3-5-13(12)15/h2-9H,1H3
InChI key:InChIKey=KEOVUBRJPDZRAX-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Br)C=CC=C1)C2=CC=C(SC)C=C2
Synonyms:
  • Methanone, (2-bromophenyl)[4-(methylthio)phenyl]-
  • (2-Bromophenyl)-(4-methylsulfanylphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.