CAS 951888-46-3

Ethyl 5-(1,3-dioxan-2-yl)-2-methoxy-α-oxobenzeneacetate

Description:

Ethyl 5-(1,3-dioxan-2-yl)-2-methoxy-α-oxobenzeneacetate, identified by its CAS number 951888-46-3, is an organic compound characterized by its complex structure that includes an ethyl ester functional group, a methoxy group, and a dioxane ring. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the dioxane moiety may contribute to its stability and potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the methoxy group can influence the compound's electronic properties, potentially affecting its reactivity and interaction with other chemical species. Ethyl 5-(1,3-dioxan-2-yl)-2-methoxy-α-oxobenzeneacetate may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. However, specific applications and biological activities would require further investigation and validation through experimental studies.

Formula: C₁₅H₁₈O₆

InChI: InChI=1S/C15H18O6/c1-3-19-14(17)13(16)11-9-10(5-6-12(11)18-2)15-20-7-4-8-21-15/h5-6,9,15H,3-4,7-8H2,1-2H3

InChI key: InChIKey=YSIROEGHQHTDTF-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(=O)C1=C(OC)C=CC(=C1)C2OCCCO2

Synonyms:

• Ethyl 5-(1,3-dioxan-2-yl)-2-methoxy-α-oxobenzeneacetate
• Benzeneacetic acid, 5-(1,3-dioxan-2-yl)-2-methoxy-α-oxo-, ethyl ester