CAS 951888-47-4
:1-Bromo-2-fluoro-4-(2-methyl-2-propen-1-yl)benzene
Description:
1-Bromo-2-fluoro-4-(2-methyl-2-propen-1-yl)benzene, with the CAS number 951888-47-4, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with a propenyl side chain. This compound features a bromine atom at the first position and a fluorine atom at the second position of the benzene ring, while the fourth position is substituted with a 2-methyl-2-propen-1-yl group, which introduces a degree of unsaturation and steric bulk. The presence of these halogen atoms typically enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the propenyl group can participate in further reactions, such as polymerization or addition reactions. The compound's unique structure may impart specific physical properties, such as solubility and boiling point, influenced by the halogen substituents and the overall molecular geometry. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C10H10BrF
InChI:InChI=1S/C10H10BrF/c1-7(2)5-8-3-4-9(11)10(12)6-8/h3-4,6H,1,5H2,2H3
InChI key:InChIKey=IZYIWNVQSRRPNV-UHFFFAOYSA-N
SMILES:C(C(C)=C)C1=CC(F)=C(Br)C=C1
Synonyms:- 1-Bromo-2-fluoro-4-(2-methyl-2-propen-1-yl)benzene
- Benzene, 1-bromo-2-fluoro-4-(2-methyl-2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoro-4-(2-methylallyl)bromobenzene
CAS:2-Fluoro-4-(2-methylallyl)bromobenzene
Molecular weight:229.09g/mol
