CymitQuimica logo

CAS 951888-52-1

:

Ethyl 2-fluoro-α-oxo[1,1′-biphenyl]-4-acetate

Description:
Ethyl 2-fluoro-α-oxo[1,1′-biphenyl]-4-acetate is an organic compound characterized by its unique structure, which includes a biphenyl moiety, an ethyl acetate group, and a fluorine atom. This compound typically exhibits a moderate level of polarity due to the presence of the ester functional group and the electronegative fluorine atom, which can influence its reactivity and solubility in various solvents. The presence of the α-oxo group suggests potential for reactivity in condensation reactions or as a precursor in synthetic pathways. Ethyl 2-fluoro-α-oxo[1,1′-biphenyl]-4-acetate may also display interesting biological activity, making it a candidate for further investigation in medicinal chemistry. Its stability, boiling and melting points, and specific reactivity would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound represents a versatile structure that could be utilized in various chemical applications, including pharmaceuticals and agrochemicals.
Formula:C16H13FO3
InChI:InChI=1S/C16H13FO3/c1-2-20-16(19)15(18)12-8-9-13(14(17)10-12)11-6-4-3-5-7-11/h3-10H,2H2,1H3
InChI key:InChIKey=VULNCFSJKGGKAQ-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(C(OCC)=O)=O)=C1)C2=CC=CC=C2
Synonyms:
  • Ethyl 2-fluoro-α-oxo[1,1′-biphenyl]-4-acetate
  • [1,1′-Biphenyl]-4-acetic acid, 2-fluoro-α-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.