CAS 951888-75-8

ε-Oxo-3-phenoxybenzenehexanoic acid

Description:

ε-Oxo-3-phenoxybenzenehexanoic acid, identified by its CAS number 951888-75-8, is a chemical compound characterized by its unique structure that includes a phenoxy group and a hexanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility and reactivity. The presence of the phenoxy group suggests potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. The hexanoic acid component contributes to its fatty acid characteristics, which may affect its physical properties such as melting point and boiling point. Additionally, the compound may exhibit specific functional behaviors, such as being a potential ligand or having antimicrobial properties, depending on its interactions with other molecules. Overall, ε-Oxo-3-phenoxybenzenehexanoic acid represents a versatile structure with potential utility in synthetic chemistry and material science.

Formula: C₁₈H₁₈O₄

InChI: InChI=1S/C18H18O4/c19-17(11-4-5-12-18(20)21)14-7-6-10-16(13-14)22-15-8-2-1-3-9-15/h1-3,6-10,13H,4-5,11-12H2,(H,20,21)

InChI key: InChIKey=NUOUSKWUPIYXDF-UHFFFAOYSA-N

SMILES: O(C1=CC(C(CCCCC(O)=O)=O)=CC=C1)C2=CC=CC=C2

Synonyms:

• ε-Oxo-3-phenoxybenzenehexanoic acid
• Benzenehexanoic acid, ε-oxo-3-phenoxy-