CymitQuimica logo

CAS 951888-85-0

:

1-(2-Chloro-2-propen-1-yl)-3-fluoro-5-methylbenzene

Description:
1-(2-Chloro-2-propen-1-yl)-3-fluoro-5-methylbenzene, also known by its CAS number 951888-85-0, is an organic compound characterized by its unique structural features. It contains a benzene ring substituted with a fluoro group, a methyl group, and a propenyl group that includes a chlorine atom. This compound exhibits properties typical of aromatic compounds, such as stability and the ability to undergo electrophilic substitution reactions. The presence of the fluorine atom can enhance its reactivity and influence its physical properties, such as boiling and melting points, while the chlorine substituent can affect its polarity and solubility in various solvents. Additionally, the propenyl group introduces a degree of unsaturation, which may allow for further chemical transformations. Overall, this compound's structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals, where specific reactivity and functionalization are desired.
Formula:C10H10ClF
InChI:InChI=1S/C10H10ClF/c1-7-3-9(5-8(2)11)6-10(12)4-7/h3-4,6H,2,5H2,1H3
InChI key:InChIKey=DJKOTFCNJCSXIW-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=CC(C)=CC(F)=C1
Synonyms:
  • Benzene, 1-(2-chloro-2-propen-1-yl)-3-fluoro-5-methyl-
  • 1-(2-Chloro-2-propen-1-yl)-3-fluoro-5-methylbenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.