CAS 951888-95-2

3-(Dimethylamino)-γ-oxobenzenebutanoic acid

Description:

3-(Dimethylamino)-γ-oxobenzenebutanoic acid, identified by its CAS number 951888-95-2, is a chemical compound that features a unique structure combining an aromatic ring with a dimethylamino group and a carboxylic acid functionality. This compound typically exhibits characteristics such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid group. The dimethylamino group can impart basic properties, allowing for interactions with acids and other electrophiles. The presence of the γ-oxo group suggests potential reactivity in various organic transformations, including condensation and nucleophilic addition reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various conformations, which can influence its chemical reactivity and interactions with biological targets. Overall, 3-(Dimethylamino)-γ-oxobenzenebutanoic acid is a versatile compound with potential applications in medicinal chemistry and organic synthesis.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1S/C12H15NO3/c1-13(2)10-5-3-4-9(8-10)11(14)6-7-12(15)16/h3-5,8H,6-7H2,1-2H3,(H,15,16)

InChI key: InChIKey=DGHGYEGMYUUPKO-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)(=O)C1=CC(N(C)C)=CC=C1

Synonyms:

• 4-(3-Dimethylaminophenyl)-4-oxobutanoic acid
• Benzenebutanoic acid, 3-(dimethylamino)-γ-oxo-
• 3-(Dimethylamino)-γ-oxobenzenebutanoic acid

4-[3-(N,N-Dimethylamino)phenyl]-4-oxobutyric acid

CAS: 951888-95-2

Formula: C₁₂H₁₅NO₃

Purity: 97.0%

Molecular weight: 221.256

Ref: 10-F207439