CymitQuimica logo

CAS 951888-99-6

:

3-(Dimethylamino)-δ-oxobenzenepentanoic acid

Description:
3-(Dimethylamino)-δ-oxobenzenepentanoic acid, identified by its CAS number 951888-99-6, is a chemical compound that features a complex structure combining both aromatic and aliphatic characteristics. It contains a dimethylamino group, which is known for its basicity and ability to participate in various chemical reactions, particularly in the formation of salts and complexes. The presence of a δ-oxobenzenepentanoic acid moiety suggests that it has both ketone and carboxylic acid functional groups, contributing to its reactivity and potential applications in organic synthesis. This compound may exhibit properties such as solubility in polar solvents, and its structure could allow for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the aromatic ring may impart stability and influence the compound's electronic properties. Overall, 3-(Dimethylamino)-δ-oxobenzenepentanoic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H17NO3
InChI:InChI=1S/C13H17NO3/c1-14(2)11-6-3-5-10(9-11)12(15)7-4-8-13(16)17/h3,5-6,9H,4,7-8H2,1-2H3,(H,16,17)
InChI key:InChIKey=BYOWZVUTTNMZLP-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)(=O)C1=CC(N(C)C)=CC=C1
Synonyms:
  • Benzenepentanoic acid, 3-(dimethylamino)-δ-oxo-
  • 3-(Dimethylamino)-δ-oxobenzenepentanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.