CAS 951889-05-7
:1-(2-Bromo-2-propen-1-yl)-3-fluoro-5-methoxybenzene
Description:
1-(2-Bromo-2-propen-1-yl)-3-fluoro-5-methoxybenzene, with the CAS number 951889-05-7, is an organic compound characterized by its unique structural features. It contains a methoxy group (-OCH3) and a fluoro substituent on a benzene ring, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of a bromoalkene side chain enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The compound's molecular structure suggests it may exhibit interesting electronic properties due to the combination of electron-donating and electron-withdrawing groups. Additionally, the presence of the fluorine atom can influence the compound's lipophilicity and biological activity, making it a candidate for further investigation in drug development. Overall, this compound's unique characteristics make it a valuable subject for research in synthetic organic chemistry and potential pharmaceutical applications.
Formula:C10H10BrFO
InChI:InChI=1S/C10H10BrFO/c1-7(11)3-8-4-9(12)6-10(5-8)13-2/h4-6H,1,3H2,2H3
InChI key:InChIKey=DDSDJLXHJSHQQL-UHFFFAOYSA-N
SMILES:C(C(Br)=C)C1=CC(OC)=CC(F)=C1
Synonyms:- 1-(2-Bromo-2-propen-1-yl)-3-fluoro-5-methoxybenzene
- Benzene, 1-(2-bromo-2-propen-1-yl)-3-fluoro-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.