CymitQuimica logo

CAS 951889-08-0

:

(2-Bromophenyl)[4-(1,1-dimethylethyl)phenyl]methanone

Description:
The chemical substance known as (2-Bromophenyl)[4-(1,1-dimethylethyl)phenyl]methanone, with the CAS number 951889-08-0, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a tert-butyl-substituted phenyl group attached to a ketone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. The presence of the bromine atom enhances its reactivity and can influence its physical properties, such as solubility and boiling point. Additionally, the bulky tert-butyl group can affect steric hindrance, potentially impacting its reactivity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential applications in synthesis and as a building block for more complex molecules. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C17H17BrO
InChI:InChI=1S/C17H17BrO/c1-17(2,3)13-10-8-12(9-11-13)16(19)14-6-4-5-7-15(14)18/h4-11H,1-3H3
InChI key:InChIKey=CTGNTZJXOMWGQZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(C)(C)C)C=C1)C2=C(Br)C=CC=C2
Synonyms:
  • Methanone, (2-bromophenyl)[4-(1,1-dimethylethyl)phenyl]-
  • (2-Bromophenyl)[4-(1,1-dimethylethyl)phenyl]methanone
  • 2-Bromo-4′-tert-Butylbenzophenone
  • (2-Bromophenyl)-(4-tert-butylphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.