CAS 951889-16-0

Ethyl 5-chloro-δ-oxo-2-thiophenepentanoate

Description:

Ethyl 5-chloro-δ-oxo-2-thiophenepentanoate is a chemical compound characterized by its unique structure, which includes a thiophene ring and an ester functional group. The presence of the chloro substituent at the 5-position of the thiophene ring contributes to its reactivity and potential applications in organic synthesis. The δ-oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. This compound is likely to exhibit moderate to high lipophilicity due to the ethyl ester and thiophene moieties, which may influence its solubility in organic solvents. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it may be used as an intermediate in the development of more complex molecules. As with many chemical substances, safety precautions should be observed when handling this compound, given the presence of chlorine and potential reactivity associated with its functional groups.

Formula: C₁₁H₁₃ClO₃S

InChI: InChI=1S/C11H13ClO3S/c1-2-15-11(14)5-3-4-8(13)9-6-7-10(12)16-9/h6-7H,2-5H2,1H3

InChI key: InChIKey=MBWYHEDACYOGKQ-UHFFFAOYSA-N

SMILES: C(CCCC(OCC)=O)(=O)C=1SC(Cl)=CC1

Synonyms:

• 2-Thiophenepentanoic acid, 5-chloro-δ-oxo-, ethyl ester
• Ethyl 5-chloro-δ-oxo-2-thiophenepentanoate