CAS 951889-26-2

4-(Diethylamino)-δ-oxobenzenepentanoic acid

Description:

4-(Diethylamino)-δ-oxobenzenepentanoic acid, with the CAS number 951889-26-2, is a chemical compound that features a complex structure characterized by the presence of a diethylamino group and a δ-oxobenzenepentanoic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The diethylamino group may impart basic characteristics, allowing for interactions with acids and other electrophiles. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Additionally, its unique arrangement of functional groups may confer specific biological activities, making it of interest in pharmaceutical research. However, detailed information regarding its reactivity, stability, and specific applications would require further investigation through empirical studies and literature reviews. As with any chemical substance, safety data and handling precautions should be consulted prior to use.

Formula: C₁₅H₂₁NO₃

InChI: InChI=1S/C15H21NO3/c1-3-16(4-2)13-10-8-12(9-11-13)14(17)6-5-7-15(18)19/h8-11H,3-7H2,1-2H3,(H,18,19)

InChI key: InChIKey=HYYKJJUUPBNXPB-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=CC=C(C(CCCC(O)=O)=O)C=C1

Synonyms:

• 4-(Diethylamino)-δ-oxobenzenepentanoic acid
• Benzenepentanoic acid, 4-(diethylamino)-δ-oxo-

5-[4-(N,N-Diethylamino)phenyl]-5-oxovaleric acid

CAS: 951889-26-2

Formula: C₁₅H₂₁NO₃

Purity: 97.0%

Molecular weight: 263.337

Ref: 10-F207450