CAS 951889-31-9

Ethyl 2,3-dihydro-γ-oxo-1,4-benzodioxin-6-butanoate

Description:

Ethyl 2,3-dihydro-γ-oxo-1,4-benzodioxin-6-butanoate is a chemical compound characterized by its unique structure, which includes a benzodioxin moiety and an ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the dioxin ring suggests that it may have interesting electronic properties, potentially influencing its behavior in chemical reactions. As an ester, it may undergo hydrolysis in the presence of water or react with nucleophiles, making it relevant in various synthetic applications. Additionally, the compound's molecular structure may impart specific biological activities, which could be of interest in medicinal chemistry. However, detailed information regarding its solubility, melting point, and specific reactivity would require empirical data or literature references. Overall, Ethyl 2,3-dihydro-γ-oxo-1,4-benzodioxin-6-butanoate represents a complex organic molecule with potential applications in chemical synthesis and pharmacology.

Formula: C₁₄H₁₆O₅

InChI: InChI=1S/C14H16O5/c1-2-17-14(16)6-4-11(15)10-3-5-12-13(9-10)19-8-7-18-12/h3,5,9H,2,4,6-8H2,1H3

InChI key: InChIKey=DMHBAJRGUOHXFS-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C=1C=C2C(=CC1)OCCO2

Synonyms:

• Ethyl 2,3-dihydro-γ-oxo-1,4-benzodioxin-6-butanoate
• 1,4-Benzodioxin-6-butanoic acid, 2,3-dihydro-γ-oxo-, ethyl ester