CymitQuimica logo

CAS 951889-45-5

:

1-(3-Bromo-3-buten-1-yl)-3-(trifluoromethyl)benzene

Description:
1-(3-Bromo-3-buten-1-yl)-3-(trifluoromethyl)benzene, with the CAS number 951889-45-5, is an organic compound characterized by its unique structure that includes a bromobutenyl group and a trifluoromethyl-substituted phenyl ring. This compound features a conjugated system due to the presence of the double bond in the butenyl moiety, which can impart reactivity typical of alkenes. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly influence the compound's chemical behavior, including its reactivity and stability. The presence of bromine also suggests potential for nucleophilic substitution reactions. This compound may be of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in synthesis and as a building block for more complex molecules. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Safety data and handling precautions should be consulted, as halogenated compounds can pose health and environmental risks.
Formula:C11H10BrF3
InChI:InChI=1S/C11H10BrF3/c1-8(12)5-6-9-3-2-4-10(7-9)11(13,14)15/h2-4,7H,1,5-6H2
InChI key:InChIKey=GAGBCHBDJZFCLT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CCC(Br)=C)=CC=C1
Synonyms:
  • Benzene, 1-(3-bromo-3-buten-1-yl)-3-(trifluoromethyl)-
  • 1-(3-Bromo-3-buten-1-yl)-3-(trifluoromethyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.