CAS 951889-48-8
:1-(2-Methyl-2-propen-1-yl)-3-(trifluoromethyl)benzene
Description:
1-(2-Methyl-2-propen-1-yl)-3-(trifluoromethyl)benzene, also known as a substituted aromatic compound, features a benzene ring with two significant substituents: a 2-methyl-2-propen-1-yl group and a trifluoromethyl group. The presence of the trifluoromethyl group (-CF3) enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. The 2-methyl-2-propen-1-yl group, which is a branched alkene, contributes to the compound's potential for undergoing various chemical reactions, including polymerization and electrophilic aromatic substitution. This compound is likely to exhibit unique physical properties, such as a relatively high boiling point due to the aromatic nature of the benzene ring and the presence of electronegative fluorine atoms. Additionally, the trifluoromethyl group can impart stability and resistance to oxidation. Overall, this compound's structure suggests potential applications in organic synthesis, materials science, and possibly in pharmaceuticals, depending on its specific reactivity and interactions.
Formula:C11H11F3
InChI:InChI=1S/C11H11F3/c1-8(2)6-9-4-3-5-10(7-9)11(12,13)14/h3-5,7H,1,6H2,2H3
InChI key:InChIKey=PLGUUSUZCSTBRM-UHFFFAOYSA-N
SMILES:C(C(C)=C)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- 1-(2-Methyl-2-propen-1-yl)-3-(trifluoromethyl)benzene
- 1-(2-Methylprop-2-enyl)-3-(trifluoromethyl)benzene
- Benzene, 1-(2-methyl-2-propen-1-yl)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.