CAS 951889-52-4

Ethyl 2,3,5,6-tetramethyl-δ-oxobenzenepentanoate

Description:

Ethyl 2,3,5,6-tetramethyl-δ-oxobenzenepentanoate, with the CAS number 951889-52-4, is a chemical compound characterized by its complex structure, which includes an ester functional group and multiple methyl substituents on a benzene ring. This compound is likely to exhibit properties typical of esters, such as being relatively non-polar and having a pleasant, fruity odor. The presence of the δ-oxobenzene moiety suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Its multiple methyl groups can influence its solubility, boiling point, and overall reactivity. Additionally, the compound may have applications in organic synthesis, potentially serving as an intermediate in the production of more complex molecules. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₇H₂₄O₃

InChI: InChI=1S/C17H24O3/c1-6-20-16(19)9-7-8-15(18)17-13(4)11(2)10-12(3)14(17)5/h10H,6-9H2,1-5H3

InChI key: InChIKey=UCBVYXHZOLLMIW-UHFFFAOYSA-N

SMILES: C(CCCC(OCC)=O)(=O)C1=C(C)C(C)=CC(C)=C1C

Synonyms:

• Benzenepentanoic acid, 2,3,5,6-tetramethyl-δ-oxo-, ethyl ester
• Ethyl 2,3,5,6-tetramethyl-δ-oxobenzenepentanoate