CAS 951889-67-1

Ethyl 4-methoxy-2-methyl-γ-oxobenzenebutanoate

Description:

Ethyl 4-methoxy-2-methyl-γ-oxobenzenebutanoate, identified by its CAS number 951889-67-1, is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. This substance features a benzene ring substituted with a methoxy group and a methyl group, contributing to its aromatic properties and influencing its reactivity and solubility. The presence of the γ-oxobutanoate moiety indicates that it has a ketone functional group adjacent to the ester, which can participate in various chemical reactions, such as nucleophilic additions. Ethyl 4-methoxy-2-methyl-γ-oxobenzenebutanoate is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula: C₁₄H₁₈O₄

InChI: InChI=1S/C14H18O4/c1-4-18-14(16)8-7-13(15)12-6-5-11(17-3)9-10(12)2/h5-6,9H,4,7-8H2,1-3H3

InChI key: InChIKey=KZZBGUFPPKEDPQ-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C1=C(C)C=C(OC)C=C1

Synonyms:

• Benzenebutanoic acid, 4-methoxy-2-methyl-γ-oxo-, ethyl ester
• Ethyl 4-methoxy-2-methyl-γ-oxobenzenebutanoate