CAS 951889-69-3

N,N-Dimethyl-3-(2-methyl-2-propen-1-yl)benzenamine

Description:

N,N-Dimethyl-3-(2-methyl-2-propen-1-yl)benzenamine, identified by its CAS number 951889-69-3, is an organic compound characterized by its amine functional group and a substituted aromatic ring. This compound features a dimethylamino group attached to a benzene ring, which is further substituted at the meta position with an allylic group (2-methyl-2-propen-1-yl). The presence of the dimethylamino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions. The allylic substituent can participate in reactions such as polymerization or addition reactions due to its unsaturation. This compound may exhibit properties typical of amines, such as solubility in polar solvents and the ability to form hydrogen bonds. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₂H₁₇N

InChI: InChI=1S/C12H17N/c1-10(2)8-11-6-5-7-12(9-11)13(3)4/h5-7,9H,1,8H2,2-4H3

InChI key: InChIKey=QZBDDAKZKHRTRP-UHFFFAOYSA-N

SMILES: C(C(C)=C)C1=CC(N(C)C)=CC=C1

Synonyms:

• N,N-Dimethyl-3-(2-methyl-2-propen-1-yl)benzenamine
• Benzenamine, N,N-dimethyl-3-(2-methyl-2-propen-1-yl)-