CAS 951889-75-1

[4-(1,1-Dimethylethyl)phenyl](2-iodophenyl)methanone

Description:

[4-(1,1-Dimethylethyl)phenyl](2-iodophenyl)methanone, with the CAS number 951889-75-1, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of the bulky tert-butyl group (1,1-dimethylethyl) on one of the phenyl rings contributes to its steric hindrance, potentially influencing its reactivity and interactions in chemical processes. The iodine atom on the second phenyl ring enhances the compound's electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting photophysical properties due to the conjugation between the aromatic systems, which can be relevant in applications such as organic electronics or photochemistry. Additionally, its unique structure may impart specific biological activities, warranting investigation in medicinal chemistry. Overall, the combination of functional groups and substituents in this compound suggests potential utility in synthetic organic chemistry and materials science.

Formula: C₁₇H₁₇IO

InChI: InChI=1S/C17H17IO/c1-17(2,3)13-10-8-12(9-11-13)16(19)14-6-4-5-7-15(14)18/h4-11H,1-3H3

InChI key: InChIKey=TUIFWIKFMZBVAE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(C)(C)C)C=C1)C2=C(I)C=CC=C2

Synonyms:

• [4-(1,1-Dimethylethyl)phenyl](2-iodophenyl)methanone
• Methanone, [4-(1,1-dimethylethyl)phenyl](2-iodophenyl)-
• (4-tert-Butylphenyl)-(2-iodophenyl)methanone

4-tert-Butyl-2′-iodobenzophenone

CAS: 951889-75-1

Formula: C₁₇H₁₇IO

Purity: 97.0%

Molecular weight: 364.226

Ref: 10-F201909