CAS 951889-76-2

4-(2-Bromo-2-propen-1-yl)-N,N-dimethylbenzenamine

Description:

4-(2-Bromo-2-propen-1-yl)-N,N-dimethylbenzenamine, with the CAS number 951889-76-2, is an organic compound characterized by its amine functional group and a substituted aromatic ring. The presence of the bromoalkene moiety indicates that it has potential for undergoing various chemical reactions, such as nucleophilic substitution or addition reactions. This compound features a dimethylamino group, which enhances its basicity and may influence its reactivity and solubility in polar solvents. The structure suggests that it could exhibit interesting electronic properties due to the conjugation between the aromatic system and the alkenyl group. Additionally, the presence of the bromine atom may impart specific reactivity, making it useful in synthetic organic chemistry. Its applications could range from being a building block in pharmaceuticals to serving as an intermediate in the synthesis of more complex molecules. However, handling and usage should be approached with caution due to the potential toxicity associated with amines and halogenated compounds.

Formula: C₁₁H₁₄BrN

InChI: InChI=1S/C11H14BrN/c1-9(12)8-10-4-6-11(7-5-10)13(2)3/h4-7H,1,8H2,2-3H3

InChI key: InChIKey=AEINQZSLQJIEFP-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=CC=C(N(C)C)C=C1

Synonyms:

• 4-(2-Bromo-2-propen-1-yl)-N,N-dimethylbenzenamine
• Benzenamine, 4-(2-bromo-2-propen-1-yl)-N,N-dimethyl-