CAS 951889-84-2

1-(3-Chloro-3-buten-1-yl)-2-ethoxybenzene

Description:

1-(3-Chloro-3-buten-1-yl)-2-ethoxybenzene, identified by its CAS number 951889-84-2, is an organic compound characterized by its unique structure, which includes a chloroalkene moiety and an ethoxy-substituted aromatic ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate volatility and potential reactivity due to the presence of the chloro group. The ethoxy group contributes to its solubility in organic solvents, while the aromatic ring may provide stability and influence its electronic properties. The presence of the chloroalkene functionality suggests potential for further chemical reactivity, including nucleophilic substitution or addition reactions. This compound may be of interest in various applications, including organic synthesis and materials science, due to its unique structural features. However, specific safety and handling guidelines should be followed, as compounds containing halogens can pose environmental and health risks. Always refer to safety data sheets and relevant literature for detailed information on handling and potential hazards.

Formula: C₁₂H₁₅ClO

InChI: InChI=1S/C12H15ClO/c1-3-14-12-7-5-4-6-11(12)9-8-10(2)13/h4-7H,2-3,8-9H2,1H3

InChI key: InChIKey=YQGWHTFGYDUKAM-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)C1=C(OCC)C=CC=C1

Synonyms:

• Benzene, 1-(3-chloro-3-buten-1-yl)-2-ethoxy-
• 1-(3-Chloro-3-buten-1-yl)-2-ethoxybenzene