CAS 951889-88-6

1-(3-Bromo-3-buten-1-yl)-2-ethoxybenzene

Description:

1-(3-Bromo-3-buten-1-yl)-2-ethoxybenzene, with the CAS number 951889-88-6, is an organic compound characterized by its unique structure that includes a bromobutenyl group and an ethoxy-substituted phenyl ring. This compound features a bromine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The ethoxy group enhances its solubility in organic solvents and can influence its electronic properties, making it a potential candidate for various chemical reactions. The presence of the butenyl moiety suggests that it may participate in addition reactions, particularly in the presence of electrophiles. Additionally, the compound's aromatic nature may impart stability and influence its interactions with other molecules. Overall, 1-(3-Bromo-3-buten-1-yl)-2-ethoxybenzene is of interest in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules or as a building block in materials science. Its specific applications would depend on its reactivity and the functional groups present in its structure.

Formula: C₁₂H₁₅BrO

InChI: InChI=1S/C12H15BrO/c1-3-14-12-7-5-4-6-11(12)9-8-10(2)13/h4-7H,2-3,8-9H2,1H3

InChI key: InChIKey=BMOSNHFJABXGJR-UHFFFAOYSA-N

SMILES: C(CC(Br)=C)C1=C(OCC)C=CC=C1

Synonyms:

• 1-(3-Bromo-3-buten-1-yl)-2-ethoxybenzene
• Benzene, 1-(3-bromo-3-buten-1-yl)-2-ethoxy-