CAS 951889-99-9
:2-(2-Chloro-2-propen-1-yl)-1,1′-biphenyl
Description:
2-(2-Chloro-2-propen-1-yl)-1,1′-biphenyl, with the CAS number 951889-99-9, is an organic compound characterized by its biphenyl structure substituted with a 2-chloro-2-propen-1-yl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of the chloroalkene group introduces potential for further chemical reactivity, particularly in electrophilic addition reactions. It is likely to be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The compound may have applications in organic synthesis, particularly in the development of agrochemicals or pharmaceuticals, due to its unique structural features. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 2-(2-Chloro-2-propen-1-yl)-1,1′-biphenyl represents a versatile building block in synthetic organic chemistry.
Formula:C15H13Cl
InChI:InChI=1S/C15H13Cl/c1-12(16)11-14-9-5-6-10-15(14)13-7-3-2-4-8-13/h2-10H,1,11H2
InChI key:InChIKey=VDBROMXYHYAAMU-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=C(C=CC=C1)C2=CC=CC=C2
Synonyms:- 1,1′-Biphenyl, 2-(2-chloro-2-propen-1-yl)-
- 2-(2-Chloro-2-propen-1-yl)-1,1′-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.