CAS 951890-05-4

2-(2-Bromo-2-propen-1-yl)-1,1′-biphenyl

Description:

2-(2-Bromo-2-propen-1-yl)-1,1′-biphenyl, identified by its CAS number 951890-05-4, is an organic compound characterized by its biphenyl structure substituted with a propenyl group that contains a bromine atom. This compound typically exhibits properties associated with both aromatic and alkenyl functionalities, which can influence its reactivity and stability. The presence of the bromine atom introduces a halogen, which can enhance electrophilic reactivity and facilitate various chemical transformations, such as nucleophilic substitutions or coupling reactions. The propenyl group contributes to the compound's unsaturation, making it potentially reactive in addition reactions. In terms of physical properties, compounds of this nature may be expected to have moderate solubility in organic solvents and exhibit distinct melting and boiling points influenced by their molecular structure. Additionally, the compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features that allow for further functionalization. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental concerns.

Formula: C₁₅H₁₃Br

InChI: InChI=1S/C15H13Br/c1-12(16)11-14-9-5-6-10-15(14)13-7-3-2-4-8-13/h2-10H,1,11H2

InChI key: InChIKey=ZGGZBAGBWXRRGU-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=C(C=CC=C1)C2=CC=CC=C2

Synonyms:

• 2-(2-Bromo-2-propen-1-yl)-1,1′-biphenyl
• 1,1′-Biphenyl, 2-(2-bromo-2-propen-1-yl)-