CAS 951890-41-8
:1-(2-Chloro-2-propen-1-yl)-2-ethoxybenzene
Description:
1-(2-Chloro-2-propen-1-yl)-2-ethoxybenzene, identified by its CAS number 951890-41-8, is an organic compound characterized by the presence of both a chloroalkene and an ethoxy group attached to a benzene ring. This compound features a vinyl group (2-chloro-2-propen-1-yl) that contributes to its reactivity, particularly in electrophilic addition reactions. The ethoxy group enhances its solubility in organic solvents and may influence its chemical behavior, including its potential as a precursor in synthetic organic chemistry. The presence of the chlorine atom introduces polar characteristics, which can affect the compound's interactions with other molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its structural features suggest potential uses in various chemical syntheses, although specific applications would depend on further research into its reactivity and stability under different conditions. Safety data and handling precautions should be considered due to the presence of chlorine and the potential for reactivity associated with the vinyl group.
Formula:C11H13ClO
InChI:InChI=1S/C11H13ClO/c1-3-13-11-7-5-4-6-10(11)8-9(2)12/h4-7H,2-3,8H2,1H3
InChI key:InChIKey=JLSUHPSTSFJDBT-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=C(OCC)C=CC=C1
Synonyms:- 1-(2-Chloro-2-propen-1-yl)-2-ethoxybenzene
- Benzene, 1-(2-chloro-2-propen-1-yl)-2-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.