CymitQuimica logo

CAS 951890-47-4

:

1-(2-Chloro-2-propen-1-yl)-4-ethoxybenzene

Description:
1-(2-Chloro-2-propen-1-yl)-4-ethoxybenzene, identified by its CAS number 951890-47-4, is an organic compound characterized by the presence of both a chloroalkene and an ethoxy group attached to a benzene ring. This compound features a vinyl chloride moiety, which contributes to its reactivity, particularly in electrophilic substitution reactions. The ethoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a potential candidate for various chemical applications, including in the synthesis of more complex molecules. The presence of the chlorine atom can also impart unique characteristics, such as increased polarity and potential for further functionalization. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Its specific applications and behavior in chemical reactions would depend on the context of its use, including the presence of other reagents and reaction conditions.
Formula:C11H13ClO
InChI:InChI=1S/C11H13ClO/c1-3-13-11-6-4-10(5-7-11)8-9(2)12/h4-7H,2-3,8H2,1H3
InChI key:InChIKey=LMXSNSRUFLPZFJ-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=CC=C(OCC)C=C1
Synonyms:
  • Benzene, 1-(2-chloro-2-propen-1-yl)-4-ethoxy-
  • 1-(2-Chloro-2-propen-1-yl)-4-ethoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.