CAS 951890-51-0

1-Ethoxy-4-(2-methyl-2-propen-1-yl)benzene

Description:

1-Ethoxy-4-(2-methyl-2-propen-1-yl)benzene, also known by its CAS number 951890-51-0, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethoxy group and a propenyl group. The ethoxy group (-OCH2CH3) contributes to its solubility in organic solvents, while the propenyl group introduces a degree of reactivity due to the presence of a double bond. This compound is likely to exhibit properties typical of both ethers and alkenes, such as moderate volatility and potential for polymerization under certain conditions. Its structure suggests it may participate in electrophilic aromatic substitution reactions, and the presence of the double bond could allow for further chemical transformations. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper use and minimize risks.

Formula: C₁₂H₁₆O

InChI: InChI=1S/C12H16O/c1-4-13-12-7-5-11(6-8-12)9-10(2)3/h5-8H,2,4,9H2,1,3H3

InChI key: InChIKey=NXTPNZMYUCFREQ-UHFFFAOYSA-N

SMILES: C(C(C)=C)C1=CC=C(OCC)C=C1

Synonyms:

• 1-Ethoxy-4-(2-methyl-2-propen-1-yl)benzene
• Benzene, 1-ethoxy-4-(2-methyl-2-propen-1-yl)-