CAS 951890-53-2
:1-(2-Chloro-2-propen-1-yl)-2-(1-methylethyl)benzene
Description:
1-(2-Chloro-2-propen-1-yl)-2-(1-methylethyl)benzene, also known by its CAS number 951890-53-2, is an organic compound characterized by its unique structure that includes a chloropropene group and an isopropyl-substituted benzene ring. This compound features a vinyl chloride moiety, which contributes to its reactivity, particularly in electrophilic substitution reactions. The presence of the isopropyl group enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of various chemical products. Additionally, the chlorinated vinyl group may impart specific properties such as increased stability under certain conditions, while also raising considerations regarding environmental and health impacts due to the presence of chlorine. As with many chlorinated compounds, it is essential to handle this substance with care, considering its potential reactivity and toxicity.
Formula:C12H15Cl
InChI:InChI=1S/C12H15Cl/c1-9(2)12-7-5-4-6-11(12)8-10(3)13/h4-7,9H,3,8H2,1-2H3
InChI key:InChIKey=KQCGYTHFIXMTNR-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(CC(=C)Cl)C=CC=C1
Synonyms:- 1-(2-Chloro-2-propen-1-yl)-2-(1-methylethyl)benzene
- Benzene, 1-(2-chloro-2-propen-1-yl)-2-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.