CAS 951890-66-7
:1-(Ethylthio)-4-(2-methyl-2-propen-1-yl)benzene
Description:
1-(Ethylthio)-4-(2-methyl-2-propen-1-yl)benzene, identified by its CAS number 951890-66-7, is an organic compound characterized by a benzene ring substituted with both an ethylthio group and an isopropenyl group. The presence of the ethylthio group introduces sulfur into the molecular structure, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. The isopropenyl group, a vinyl derivative, contributes to the compound's potential for polymerization and reactivity in various chemical reactions. This compound is likely to be a colorless to pale yellow liquid, exhibiting typical aromatic characteristics, including a distinct odor. Its applications may span across fields such as organic synthesis, fragrance formulation, or as an intermediate in the production of other chemical compounds. As with many organic compounds, safety precautions should be observed when handling it, considering potential toxicity and reactivity.
Formula:C12H16S
InChI:InChI=1S/C12H16S/c1-4-13-12-7-5-11(6-8-12)9-10(2)3/h5-8H,2,4,9H2,1,3H3
InChI key:InChIKey=WJVTUDCJNNHKPO-UHFFFAOYSA-N
SMILES:C(C(C)=C)C1=CC=C(SCC)C=C1
Synonyms:- Benzene, 1-(ethylthio)-4-(2-methyl-2-propen-1-yl)-
- 1-(Ethylthio)-4-(2-methyl-2-propen-1-yl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.