CAS 951890-79-2
:1-(2-Chloro-2-propen-1-yl)-4-propylbenzene
Description:
1-(2-Chloro-2-propen-1-yl)-4-propylbenzene, also known by its CAS number 951890-79-2, is an organic compound characterized by a benzene ring substituted with a propyl group and a 2-chloro-2-propen-1-yl group. This compound features a vinyl chloride moiety, which contributes to its reactivity, particularly in electrophilic substitution reactions. The presence of the chlorine atom introduces polar characteristics, potentially affecting its solubility and reactivity in various chemical environments. The propyl group enhances hydrophobic interactions, making the compound less soluble in water but more soluble in organic solvents. Its structure suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as the chlorine substituent may pose health risks, and appropriate precautions should be taken during its use in laboratory or industrial settings.
Formula:C12H15Cl
InChI:InChI=1S/C12H15Cl/c1-3-4-11-5-7-12(8-6-11)9-10(2)13/h5-8H,2-4,9H2,1H3
InChI key:InChIKey=GBUNNVYQAYRFBU-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=CC=C(CCC)C=C1
Synonyms:- Benzene, 1-(2-chloro-2-propen-1-yl)-4-propyl-
- 1-(2-Chloro-2-propen-1-yl)-4-propylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.