CAS 951890-94-1

(3-Chloro-4-methylphenyl)(3-iodophenyl)methanone

Description:

(3-Chloro-4-methylphenyl)(3-iodophenyl)methanone, with the CAS number 951890-94-1, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with both a chloro and a methyl group on one aromatic ring, while the other ring contains an iodine substituent. This compound is likely to exhibit significant lipophilicity due to its multiple aromatic rings, which can influence its solubility and reactivity. The presence of halogen atoms (chlorine and iodine) can also impart unique electronic properties, potentially affecting its reactivity in nucleophilic substitution reactions. Additionally, the compound may have applications in medicinal chemistry or materials science, given the importance of halogenated compounds in drug design and synthesis. Its stability, reactivity, and potential biological activity would depend on the specific conditions under which it is used, including solvent, temperature, and the presence of other reagents.

Formula: C₁₄H₁₀ClIO

InChI: InChI=1S/C14H10ClIO/c1-9-5-6-11(8-13(9)15)14(17)10-3-2-4-12(16)7-10/h2-8H,1H3

InChI key: InChIKey=AWMIVVOVTUGGDG-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(C)C=C1)C2=CC(I)=CC=C2

Synonyms:

• (3-Chloro-4-methylphenyl)(3-iodophenyl)methanone
• Methanone, (3-chloro-4-methylphenyl)(3-iodophenyl)-