CAS 951891-07-9

1-(2-Chloro-2-propen-1-yl)-2,4-dimethoxybenzene

Description:

1-(2-Chloro-2-propen-1-yl)-2,4-dimethoxybenzene, with the CAS number 951891-07-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a propenyl group containing a chlorine atom. The presence of the methoxy groups contributes to its potential reactivity and solubility properties, while the propenyl group introduces a site for further chemical reactions, such as polymerization or electrophilic substitution. This compound may exhibit moderate to high lipophilicity due to its hydrophobic aromatic system, making it potentially useful in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its chlorine substituent can also influence its biological activity and environmental behavior. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, the unique combination of functional groups in this compound suggests a diverse range of chemical reactivity and potential applications in synthetic chemistry.

Formula: C₁₁H₁₃ClO₂

InChI: InChI=1S/C11H13ClO2/c1-8(12)6-9-4-5-10(13-2)7-11(9)14-3/h4-5,7H,1,6H2,2-3H3

InChI key: InChIKey=YWMITLLGLFNCBC-UHFFFAOYSA-N

SMILES: C(C(=C)Cl)C1=C(OC)C=C(OC)C=C1

Synonyms:

• 1-(2-Chloro-2-propen-1-yl)-2,4-dimethoxybenzene
• Benzene, 1-(2-chloro-2-propen-1-yl)-2,4-dimethoxy-