CAS 951891-18-2
:Methanone, (4-chloro-3-methylphenyl)(2-iodophenyl)-
Description:
Methanone, (4-chloro-3-methylphenyl)(2-iodophenyl)-, identified by its CAS number 951891-18-2, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic substituents. The structure features a methanone core, where a carbonyl group (C=O) is bonded to a phenyl ring that is further substituted with a chlorine atom at the para position and a methyl group at the meta position. Additionally, the compound includes another phenyl ring that is substituted with an iodine atom at the ortho position. This combination of halogen and methyl substituents can influence the compound's reactivity, stability, and potential applications in organic synthesis or medicinal chemistry. The presence of halogens often enhances the compound's lipophilicity and can affect its biological activity. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility would depend on the specific molecular interactions and the overall structure of the compound.
Formula:C14H10ClIO
InChI:InChI=1S/C14H10ClIO/c1-9-8-10(6-7-12(9)15)14(17)11-4-2-3-5-13(11)16/h2-8H,1H3
InChI key:InChIKey=HMDGQQYBTATBRU-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(Cl)C=C1)C2=C(I)C=CC=C2
Synonyms:- (4-Chloro-3-methylphenyl)-(2-iodophenyl)methanone
- 4-Chloro-2′-iodo-3-methylbenzophenone
- Methanone, (4-chloro-3-methylphenyl)(2-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.