CymitQuimica logo

CAS 951891-20-6

:

(4-Chloro-3-methylphenyl)(3-iodophenyl)methanone

Description:
(4-Chloro-3-methylphenyl)(3-iodophenyl)methanone, with the CAS number 951891-20-6, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the presence of the methanone moiety, which is attached to two distinct aromatic rings. One ring contains a chlorine substituent at the para position and a methyl group at the meta position, while the other ring has an iodine substituent at the meta position. This compound is likely to exhibit properties typical of aromatic ketones, such as stability and potential reactivity in electrophilic substitution reactions. The presence of halogen atoms (chlorine and iodine) can influence its reactivity, solubility, and biological activity, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's molecular structure suggests potential applications in the synthesis of more complex molecules or as a precursor in organic synthesis. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C14H10ClIO
InChI:InChI=1S/C14H10ClIO/c1-9-7-11(5-6-13(9)15)14(17)10-3-2-4-12(16)8-10/h2-8H,1H3
InChI key:InChIKey=YRVXHCVTXALYMX-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(Cl)C=C1)C2=CC(I)=CC=C2
Synonyms:
  • (4-Chloro-3-methylphenyl)(3-iodophenyl)methanone
  • Methanone, (4-chloro-3-methylphenyl)(3-iodophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.