CAS 951891-33-1

4-(3-Chloro-3-buten-1-yl)-1,2-dimethoxybenzene

Description:

4-(3-Chloro-3-buten-1-yl)-1,2-dimethoxybenzene, identified by its CAS number 951891-33-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a chloroalkene side chain. The presence of the methoxy groups contributes to its potential as a versatile building block in organic synthesis, influencing its reactivity and solubility. The chloroalkene moiety introduces a site for nucleophilic attack, making it useful in various chemical reactions, including cross-coupling and substitution reactions. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns. Overall, this compound represents a valuable entity in the field of synthetic organic chemistry.

Formula: C₁₂H₁₅ClO₂

InChI: InChI=1S/C12H15ClO2/c1-9(13)4-5-10-6-7-11(14-2)12(8-10)15-3/h6-8H,1,4-5H2,2-3H3

InChI key: InChIKey=NIZKETJJEDDIKU-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=CC(CCC(=C)Cl)=C1

Synonyms:

• 4-(3-Chloro-3-buten-1-yl)-1,2-dimethoxybenzene
• Benzene, 4-(3-chloro-3-buten-1-yl)-1,2-dimethoxy-