CymitQuimica logo

CAS 951891-36-4

:

4-(3-Bromo-3-buten-1-yl)-1,2-dimethoxybenzene

Description:
4-(3-Bromo-3-buten-1-yl)-1,2-dimethoxybenzene, with the CAS number 951891-36-4, is an organic compound characterized by its unique structure, which includes a bromobutenyl group and a dimethoxy-substituted benzene ring. This compound features a conjugated system due to the presence of the double bond in the butenyl chain, which can influence its reactivity and stability. The bromine atom introduces a site for potential nucleophilic substitution reactions, while the methoxy groups enhance the electron density on the aromatic ring, potentially affecting its electrophilic aromatic substitution reactions. The presence of these functional groups suggests that the compound may exhibit interesting chemical properties, such as varying solubility in organic solvents and potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the compound's structure may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its reactivity and potential applications.
Formula:C12H15BrO2
InChI:InChI=1S/C12H15BrO2/c1-9(13)4-5-10-6-7-11(14-2)12(8-10)15-3/h6-8H,1,4-5H2,2-3H3
InChI key:InChIKey=OPEHRNOZFPFPQK-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(CCC(Br)=C)=C1
Synonyms:
  • Benzene, 4-(3-bromo-3-buten-1-yl)-1,2-dimethoxy-
  • 4-(3-Bromo-3-buten-1-yl)-1,2-dimethoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.