CAS 951891-37-5

2-Chloro-6-fluoro-ζ-oxobenzeneheptanoic acid

Description:

2-Chloro-6-fluoro-ζ-oxobenzeneheptanoic acid, with the CAS number 951891-37-5, is a synthetic organic compound characterized by its unique structure that includes a benzene ring substituted with chlorine and fluorine atoms, as well as a heptanoic acid chain. The presence of the chlorine and fluorine substituents typically influences the compound's reactivity, polarity, and potential biological activity. The oxo group (carbonyl) contributes to its acidity and can participate in various chemical reactions, such as nucleophilic attacks. This compound may exhibit properties relevant to pharmaceuticals or agrochemicals, given its structural features. Its solubility, stability, and interaction with biological systems would depend on the specific functional groups and their spatial arrangement. As with many halogenated compounds, it is essential to consider environmental and health implications, including potential toxicity and persistence in biological systems. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₁₃H₁₄ClFO₃

InChI: InChI=1S/C13H14ClFO3/c14-9-5-4-6-10(15)13(9)11(16)7-2-1-3-8-12(17)18/h4-6H,1-3,7-8H2,(H,17,18)

InChI key: InChIKey=JOBXTKDTAXOXPX-UHFFFAOYSA-N

SMILES: C(CCCCCC(O)=O)(=O)C1=C(Cl)C=CC=C1F

Synonyms:

• Benzeneheptanoic acid, 2-chloro-6-fluoro-ζ-oxo-
• 2-Chloro-6-fluoro-ζ-oxobenzeneheptanoic acid

7-(2-Chloro-6-fluorophenyl)-7-oxoheptanoic acid

CAS: 951891-37-5

Formula: C₁₃H₁₄ClFO₃

Purity: 97.0%

Molecular weight: 272.7

Ref: 10-F207482