CAS 951891-45-5

1-(3-Chloro-3-buten-1-yl)-3,5-dimethoxybenzene

Description:

1-(3-Chloro-3-buten-1-yl)-3,5-dimethoxybenzene, identified by its CAS number 951891-45-5, is an organic compound characterized by its unique structure, which includes a substituted benzene ring and a chloroalkene side chain. The presence of two methoxy groups at the 3 and 5 positions of the benzene ring contributes to its chemical reactivity and solubility properties, often enhancing its lipophilicity. The chloroalkene moiety introduces potential for electrophilic reactions, making it a candidate for various synthetic applications in organic chemistry. This compound may exhibit biological activity, which is common among structurally similar compounds, and could be of interest in medicinal chemistry. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can impart toxicity. Overall, this compound represents a versatile structure for further exploration in chemical research and applications.

Formula: C₁₂H₁₅ClO₂

InChI: InChI=1S/C12H15ClO2/c1-9(13)4-5-10-6-11(14-2)8-12(7-10)15-3/h6-8H,1,4-5H2,2-3H3

InChI key: InChIKey=DBEOPVFGYRSRKC-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)C1=CC(OC)=CC(OC)=C1

Synonyms:

• 1-(3-Chloro-3-buten-1-yl)-3,5-dimethoxybenzene
• Benzene, 1-(3-chloro-3-buten-1-yl)-3,5-dimethoxy-