CymitQuimica logo

CAS 951891-50-2

:

Methanone, (3,4-dichlorophenyl)(4-iodophenyl)-

Description:
Methanone, (3,4-dichlorophenyl)(4-iodophenyl)-, also known by its CAS number 951891-50-2, is an organic compound characterized by its ketone functional group and the presence of multiple halogen substituents on its aromatic rings. This compound features a methanone (or ketone) moiety bonded to two distinct phenyl groups: one substituted with two chlorine atoms at the 3 and 4 positions, and the other with an iodine atom at the 4 position. The presence of these halogens can significantly influence the compound's reactivity, stability, and solubility, often enhancing its biological activity and potential applications in pharmaceuticals or agrochemicals. The molecular structure suggests that it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens, which can affect its interactions in chemical reactions. Additionally, the compound's physical properties, such as melting point and solubility, would be influenced by the steric and electronic effects of the substituents. Overall, this compound represents a class of halogenated organic molecules with potential utility in various chemical applications.
Formula:C13H7Cl2IO
InChI:InChI=1S/C13H7Cl2IO/c14-11-6-3-9(7-12(11)15)13(17)8-1-4-10(16)5-2-8/h1-7H
InChI key:InChIKey=CNQAFPGAWSQBNP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(I)C=C2
Synonyms:
  • Methanone, (3,4-dichlorophenyl)(4-iodophenyl)-
  • (3,4-Dichlorophenyl)-(4-iodophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.