CAS 951891-71-7
:(3,4-Difluorophenyl)(3-iodophenyl)methanone
Description:
(3,4-Difluorophenyl)(3-iodophenyl)methanone, with the CAS number 951891-71-7, is an organic compound characterized by the presence of both fluorine and iodine substituents on its aromatic rings. This compound features a ketone functional group, which is indicated by the "methanone" part of its name, suggesting that it has a carbonyl group (C=O) bonded to a carbon atom that is also connected to two distinct phenyl groups. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity, while iodine can impart unique properties due to its larger atomic size and lower electronegativity. The compound may exhibit interesting chemical behavior, including potential applications in medicinal chemistry or materials science, owing to the electronic effects of the halogen substituents. Additionally, its structural features may allow for specific interactions in biological systems, making it a candidate for further research in drug development or as a chemical probe.
Formula:C13H7F2IO
InChI:InChI=1S/C13H7F2IO/c14-11-5-4-9(7-12(11)15)13(17)8-2-1-3-10(16)6-8/h1-7H
InChI key:InChIKey=UNBGRVIJMXBSHT-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C2=CC(I)=CC=C2
Synonyms:- Methanone, (3,4-difluorophenyl)(3-iodophenyl)-
- (3,4-Difluorophenyl)(3-iodophenyl)methanone
- 3,4-DIFLUORO-3'-IODOBENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.