CAS 951891-72-8
:1-(3-Bromo-3-buten-1-yl)-2,4-dimethylbenzene
Description:
1-(3-Bromo-3-buten-1-yl)-2,4-dimethylbenzene, with the CAS number 951891-72-8, is an organic compound characterized by its unique structure that includes a bromobutenyl group attached to a dimethyl-substituted benzene ring. This compound features a conjugated system due to the presence of the double bond in the butenyl chain, which can impart reactivity typical of alkenes, such as electrophilic addition reactions. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. The dimethyl groups on the benzene ring contribute to steric hindrance and can affect the compound's overall stability and reactivity. Additionally, the presence of both aliphatic and aromatic components suggests potential applications in organic synthesis, particularly in the development of more complex molecules. Overall, this compound exemplifies the interplay between structural features and chemical behavior in organic chemistry.
Formula:C12H15Br
InChI:InChI=1S/C12H15Br/c1-9-4-6-12(10(2)8-9)7-5-11(3)13/h4,6,8H,3,5,7H2,1-2H3
InChI key:InChIKey=ODODSGUASPXHKE-UHFFFAOYSA-N
SMILES:C(CC(Br)=C)C1=C(C)C=C(C)C=C1
Synonyms:- 1-(3-Bromo-3-buten-1-yl)-2,4-dimethylbenzene
- Benzene, 1-(3-bromo-3-buten-1-yl)-2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.