CAS 951891-74-0

(3,4-Difluorophenyl)(4-iodophenyl)methanone

Description:

(3,4-Difluorophenyl)(4-iodophenyl)methanone, with the CAS number 951891-74-0, is an organic compound characterized by its unique structure, which includes a ketone functional group attached to two aromatic rings. The presence of fluorine and iodine substituents on the phenyl rings significantly influences its chemical properties, such as reactivity and polarity. The difluorophenyl group introduces electron-withdrawing effects, which can enhance the compound's electrophilicity, while the iodo substituent may facilitate nucleophilic substitution reactions. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature and the presence of halogen atoms, which can also affect its physical properties, such as melting and boiling points. Additionally, the compound may have applications in medicinal chemistry and material science, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Its specific reactivity and interactions would depend on the surrounding chemical environment and the presence of other functional groups.

Formula: C₁₃H₇F₂IO

InChI: InChI=1S/C13H7F2IO/c14-11-6-3-9(7-12(11)15)13(17)8-1-4-10(16)5-2-8/h1-7H

InChI key: InChIKey=MOACLHVWLJRANL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C=C1)C2=CC=C(I)C=C2

Synonyms:

• Methanone, (3,4-difluorophenyl)(4-iodophenyl)-
• (3,4-Difluorophenyl)(4-iodophenyl)methanone