CAS 951891-75-1

2,4-Dimethyl-1-(3-methyl-3-buten-1-yl)benzene

Description:

2,4-Dimethyl-1-(3-methyl-3-buten-1-yl)benzene, also known by its CAS number 951891-75-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups at the 2 and 4 positions and a side chain featuring a 3-methyl-3-buten-1-yl group. This compound is part of the class of alkyl-substituted benzenes, which are known for their hydrophobic properties and potential applications in organic synthesis and as intermediates in the production of various chemicals. The presence of multiple methyl groups contributes to its volatility and reactivity, making it a candidate for further chemical transformations. Additionally, the compound's structure suggests it may exhibit interesting physical properties, such as a relatively low boiling point and moderate solubility in organic solvents. Its potential uses could extend to the fragrance industry or as a building block in the synthesis of more complex organic molecules. However, specific safety and handling information should be consulted from reliable sources before working with this substance.

Formula: C₁₃H₁₈

InChI: InChI=1S/C13H18/c1-10(2)5-7-13-8-6-11(3)9-12(13)4/h6,8-9H,1,5,7H2,2-4H3

InChI key: InChIKey=LEQPEGJZBCUOSV-UHFFFAOYSA-N

SMILES: C(CC(C)=C)C1=C(C)C=C(C)C=C1

Synonyms:

• 2,4-Dimethyl-1-(3-methyl-3-buten-1-yl)benzene
• Benzene, 2,4-dimethyl-1-(3-methyl-3-buten-1-yl)-