CAS 951891-86-4

(3,5-Difluorophenyl)(4-iodophenyl)methanone

Description:

(3,5-Difluorophenyl)(4-iodophenyl)methanone is an organic compound characterized by its unique structure, which includes a ketone functional group attached to two aromatic rings. The presence of fluorine and iodine substituents on the phenyl rings significantly influences its chemical properties, including reactivity and polarity. The fluorine atoms, being electronegative, can enhance the compound's lipophilicity and may affect its interaction with biological targets, making it of interest in medicinal chemistry. The iodine atom, being larger and less electronegative, can introduce steric effects and may also play a role in the compound's reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit interesting photophysical properties due to the presence of halogens, which can affect its electronic structure. Additionally, its potential applications could span various fields, including pharmaceuticals and materials science, where such halogenated compounds are often explored for their unique properties. Overall, (3,5-Difluorophenyl)(4-iodophenyl)methanone is a versatile compound with significant implications in chemical research and development.

Formula: C₁₃H₇F₂IO

InChI: InChI=1S/C13H7F2IO/c14-10-5-9(6-11(15)7-10)13(17)8-1-3-12(16)4-2-8/h1-7H

InChI key: InChIKey=GCPFCWAYOPYWGW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(I)C=C2

Synonyms:

• Methanone, (3,5-difluorophenyl)(4-iodophenyl)-
• (3,5-Difluorophenyl)(4-iodophenyl)methanone