CAS 951891-88-6

3,4,5-Trimethoxy-ζ-oxobenzeneheptanoic acid

Description:

3,4,5-Trimethoxy-ζ-oxobenzeneheptanoic acid, identified by its CAS number 951891-88-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzene ring substituted with three methoxy groups and a heptanoic acid moiety. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its biological activity. The "ζ-oxo" designation indicates the presence of a ketone functional group, which can play a significant role in the compound's reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. However, detailed studies on its toxicity, stability, and efficacy are essential for understanding its full potential and safety profile. As with many synthetic compounds, proper handling and storage conditions are crucial to maintain its integrity and prevent degradation.

Formula: C₁₆H₂₂O₆

InChI: InChI=1S/C16H22O6/c1-20-13-9-11(10-14(21-2)16(13)22-3)12(17)7-5-4-6-8-15(18)19/h9-10H,4-8H2,1-3H3,(H,18,19)

InChI key: InChIKey=LUBTWZKEGFQQPJ-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=C(C(CCCCCC(O)=O)=O)C=C1OC

Synonyms:

• 3,4,5-Trimethoxy-ζ-oxobenzeneheptanoic acid
• Benzeneheptanoic acid, 3,4,5-trimethoxy-ζ-oxo-

7-(3,4,5-trimethoxyphenyl)-7-oxoheptanoic acid

CAS: 951891-88-6

Formula: C₁₆H₂₂O₆

Purity: 97.0%

Molecular weight: 310.346

Ref: 10-F207502