CAS 951891-90-0

1,4-Dimethyl-2-(3-methyl-3-buten-1-yl)benzene

Description:

1,4-Dimethyl-2-(3-methyl-3-buten-1-yl)benzene, also known by its CAS number 951891-90-0, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a side chain featuring a branched alkene. This compound exhibits hydrophobic properties due to its non-polar hydrocarbon structure, making it insoluble in water but soluble in organic solvents. Its molecular structure suggests potential reactivity typical of alkenes, such as undergoing addition reactions. The presence of multiple methyl groups contributes to its volatility and may influence its physical properties, such as boiling and melting points. Additionally, the compound may possess interesting aromatic characteristics, potentially making it relevant in the synthesis of fragrances or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken due to potential health hazards associated with exposure.

Formula: C₁₃H₁₈

InChI: InChI=1S/C13H18/c1-10(2)5-8-13-9-11(3)6-7-12(13)4/h6-7,9H,1,5,8H2,2-4H3

InChI key: InChIKey=HRBBRZPPPOMQGI-UHFFFAOYSA-N

SMILES: C(CC(C)=C)C1=C(C)C=CC(C)=C1

Synonyms:

• 1,4-Dimethyl-2-(3-methyl-3-buten-1-yl)benzene
• Benzene, 1,4-dimethyl-2-(3-methyl-3-buten-1-yl)-