CAS 951891-92-2
:(3,4-Dimethoxyphenyl)(3-iodophenyl)methanone
Description:
(3,4-Dimethoxyphenyl)(3-iodophenyl)methanone, with the CAS number 951891-92-2, is an organic compound characterized by its structure, which includes a ketone functional group attached to two aromatic rings. The presence of methoxy groups (-OCH3) on one of the phenyl rings enhances its electron-donating properties, potentially influencing its reactivity and solubility in organic solvents. The iodine substituent on the other phenyl ring introduces significant steric and electronic effects, which can affect the compound's stability and reactivity in various chemical reactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would typically depend on the specific interactions between its molecular structure and the solvent environment. Overall, (3,4-Dimethoxyphenyl)(3-iodophenyl)methanone represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C15H13IO3
InChI:InChI=1S/C15H13IO3/c1-18-13-7-6-11(9-14(13)19-2)15(17)10-4-3-5-12(16)8-10/h3-9H,1-2H3
InChI key:InChIKey=JMSBROOMAKIXCG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=C(OC)C=C1)C2=CC(I)=CC=C2
Synonyms:- (3,4-Dimethoxyphenyl)(3-iodophenyl)methanone
- Methanone, (3,4-dimethoxyphenyl)(3-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.