CymitQuimica logo

CAS 951892-00-5

:

2,4,5-Trimethoxy-η-oxobenzeneoctanoic acid

Description:
2,4,5-Trimethoxy-η-oxobenzeneoctanoic acid, identified by its CAS number 951892-00-5, is a chemical compound that features a complex structure characterized by the presence of multiple methoxy groups and a long-chain carboxylic acid. The presence of three methoxy groups at the 2, 4, and 5 positions on the benzene ring enhances its solubility in organic solvents and may influence its reactivity and biological activity. The η-oxo functional group suggests the presence of a ketone or related structure, which can contribute to the compound's chemical properties, including potential reactivity in various organic reactions. The octanoic acid moiety indicates that the compound has a hydrophobic tail, which may affect its interactions in biological systems and its potential applications in pharmaceuticals or agrochemicals. Overall, this compound's unique combination of functional groups may provide interesting properties for research in medicinal chemistry or material science, although specific applications would depend on further studies and characterization.
Formula:C17H24O6
InChI:InChI=1S/C17H24O6/c1-21-14-11-16(23-3)15(22-2)10-12(14)13(18)8-6-4-5-7-9-17(19)20/h10-11H,4-9H2,1-3H3,(H,19,20)
InChI key:InChIKey=RAHUICKUHWZUJN-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(=O)C1=C(OC)C=C(OC)C(OC)=C1
Synonyms:
  • 2,4,5-Trimethoxy-η-oxobenzeneoctanoic acid
  • Benzeneoctanoic acid, 2,4,5-trimethoxy-η-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.